C18H25NO2 — CID 50922838
(5S,6S)-5-ethyl-1-[(1S)-2-hydroxy-1-phenylethyl]-6-prop-2-enylpiperidin-2-one (PubChem CID 50922838) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (5S,6S)-5-ethyl-1-[(1S)-2-hydroxy-1-phenylethyl]-6-prop-2-enylpiperidin-2-one.
| Compound Name | (5S,6S)-5-ethyl-1-[(1S)-2-hydroxy-1-phenylethyl]-6-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 50922838 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (5S,6S)-5-ethyl-1-[(1S)-2-hydroxy-1-phenylethyl]-6-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1[C@@H](CC)CCC(=O)N1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-3-8-16-14(4-2)11-12-18(21)19(16)17(13-20)15-9-6-5-7-10-15/h3,5-7,9-10,14,16-17,20H,1,4,8,11-13H2,2H3/t14-,16-,17+/m0/s1 |
| InChIKey | WZOCMMVFZDHYOI-BHYGNILZSA-N |
| XLogP | 3.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|