C14H13F3O3 — CID 50922993
ethyl (1S,2S,6R,7R)-5-oxo-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-3-carboxylate (PubChem CID 50922993) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is ethyl (1S,2S,6R,7R)-5-oxo-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-3-carboxylate.
| Compound Name | ethyl (1S,2S,6R,7R)-5-oxo-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-3-carboxylate |
|---|---|
| PubChem CID | 50922993 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | ethyl (1S,2S,6R,7R)-5-oxo-4-(trifluoromethyl)tricyclo[5.2.1.02,6]deca-3,8-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)C(=O)[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H13F3O3/c1-2-20-13(19)10-8-6-3-4-7(5-6)9(8)12(18)11(10)14(15,16)17/h3-4,6-9H,2,5H2,1H3/t6-,7+,8+,9-/m1/s1 |
| InChIKey | UZMZVIFXWKVIDK-RYPBNFRJSA-N |
| XLogP | 2.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|