About CID 50923065
CID 50923065 (PubChem CID 50923065) has the molecular formula C25H35O10
and a molecular weight of 495.55 g/mol.
Molecular Properties
| Compound Name | CID 50923065 |
| PubChem CID | 50923065 |
| Molecular Formula | C25H35O10 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)[C]1[C](C(=O)OC(C)C)[C](C(=O)OC(C)C)[C](C(=O)OC(C)C)[C]1C(=O)OC(C)C |
| InChI | InChI=1S/C25H35O10/c1-11(2)31-21(26)16-17(22(27)32-12(3)4)19(24(29)34-14(7)8)20(25(30)35-15(9)10)18(16)23(28)33-13(5)6/h11-15H,1-10H3 |
| InChIKey | QEKDZYQOVDJNMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze CID 50923065 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50923065?
The IUPAC name of CID 50923065 (CID 50923065) is not available.
What is the SMILES notation for CID 50923065?
The canonical SMILES for CID 50923065 is CC(C)OC(=O)[C]1[C](C(=O)OC(C)C)[C](C(=O)OC(C)C)[C](C(=O)OC(C)C)[C]1C(=O)OC(C)C.
What is the InChIKey of CID 50923065?
The InChIKey is QEKDZYQOVDJNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35O10/c1-11(2)31-21(26)16-17(22(27)32-12(3)4)19(24(29)34-14(7)8)20(25(30)35-15(9)10)18(16)23(28)33-13(5)6/h11-15H,1-10H3.
What are the key properties of CID 50923065?
CID 50923065 has a molecular weight of 495.55 g/mol, XLogP of 2.63, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50923065 is sourced from PubChem (CID 50923065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).