C29H32N6O5 — CID 50923262
8-[4-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]anilino]-6-(6-methoxypyrazin-2-yl)-2H-2,7-naphthyridin-1-one (PubChem CID 50923262) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is 8-[4-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]anilino]-6-(6-methoxypyrazin-2-yl)-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-[4-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]anilino]-6-(6-methoxypyrazin-2-yl)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 50923262 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 8-[4-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]anilino]-6-(6-methoxypyrazin-2-yl)-2H-2,7-naphthyridin-1-one |
| SMILES | COCCOCC(=O)N1CCC(c2ccc(Nc3nc(-c4cncc(OC)n4)cc4cc[nH]c(=O)c34)cc2)CC1 |
| InChI | InChI=1S/C29H32N6O5/c1-38-13-14-40-18-26(36)35-11-8-20(9-12-35)19-3-5-22(6-4-19)32-28-27-21(7-10-31-29(27)37)15-23(34-28)24-16-30-17-25(33-24)39-2/h3-7,10,15-17,20H,8-9,11-14,18H2,1-2H3,(H,31,37)(H,32,34) |
| InChIKey | BBIMJEYGIJRORP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|