About [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid
[4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid (PubChem CID 50923595) has the molecular formula C14H12BN3O4
and a molecular weight of 297.08 g/mol. Its IUPAC name is [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid |
| PubChem CID | 50923595 |
| Molecular Formula | C14H12BN3O4 |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2cn(-c3cc(O)cc(O)c3)nn2)cc1 |
| InChI | InChI=1S/C14H12BN3O4/c19-12-5-11(6-13(20)7-12)18-8-14(16-17-18)9-1-3-10(4-2-9)15(21)22/h1-8,19-22H |
| InChIKey | GXXBAFGTYLYMBP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid?
The IUPAC name of [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid (CID 50923595) is [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid.
What is the SMILES notation for [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid?
The canonical SMILES for [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid is OB(O)c1ccc(-c2cn(-c3cc(O)cc(O)c3)nn2)cc1.
What is the InChIKey of [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid?
The InChIKey is GXXBAFGTYLYMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BN3O4/c19-12-5-11(6-13(20)7-12)18-8-14(16-17-18)9-1-3-10(4-2-9)15(21)22/h1-8,19-22H.
What are the key properties of [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid?
[4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid has a molecular weight of 297.08 g/mol, XLogP of 0.03, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(3,5-dihydroxyphenyl)triazol-4-yl]phenyl]boronic acid is sourced from PubChem (CID 50923595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).