About propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate
propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 50923959) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 50923959 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC(C)OC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C10H11NO3/c1-6(2)14-10(12)8-5-9-7(11-8)3-4-13-9/h3-6,11H,1-2H3 |
| InChIKey | BYAKKSQRFVKMEB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 50923959) is propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate is CC(C)OC(=O)c1cc2occc2[nH]1.
What is the InChIKey of propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is BYAKKSQRFVKMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-6(2)14-10(12)8-5-9-7(11-8)3-4-13-9/h3-6,11H,1-2H3.
What are the key properties of propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate?
propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 193.20 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 50923959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).