About cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate
cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 50923962) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 50923962 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | O=C(OCC1CCCCC1)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C14H17NO3/c16-14(18-9-10-4-2-1-3-5-10)12-8-13-11(15-12)6-7-17-13/h6-8,10,15H,1-5,9H2 |
| InChIKey | ZDMFJUDVTCHXAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 50923962) is cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate is O=C(OCC1CCCCC1)c1cc2occc2[nH]1.
What is the InChIKey of cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is ZDMFJUDVTCHXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c16-14(18-9-10-4-2-1-3-5-10)12-8-13-11(15-12)6-7-17-13/h6-8,10,15H,1-5,9H2.
What are the key properties of cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 247.29 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 50923962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).