About 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate
4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 50924105) has the molecular formula C15H10N2O6
and a molecular weight of 314.25 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 50924105 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | O=C(OCOC(=O)c1cc2occc2[nH]1)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C15H10N2O6/c18-14(10-5-12-8(16-10)1-3-20-12)22-7-23-15(19)11-6-13-9(17-11)2-4-21-13/h1-6,16-17H,7H2 |
| InChIKey | QYISBZUJXFWHMR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 50924105) is 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate is O=C(OCOC(=O)c1cc2occc2[nH]1)c1cc2occc2[nH]1.
What is the InChIKey of 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is QYISBZUJXFWHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O6/c18-14(10-5-12-8(16-10)1-3-20-12)22-7-23-15(19)11-6-13-9(17-11)2-4-21-13/h1-6,16-17H,7H2.
What are the key properties of 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate?
4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 314.25 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrole-5-carbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 50924105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).