About 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile
3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile (PubChem CID 50924177) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile |
| PubChem CID | 50924177 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile |
| SMILES | C=CC[C@@](O)(/C=C/c1ccccc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H17NO/c1-2-12-19(21,13-11-16-7-4-3-5-8-16)18-10-6-9-17(14-18)15-20/h2-11,13-14,21H,1,12H2/b13-11+/t19-/m1/s1 |
| InChIKey | XTKJPAAXMLKTRR-XSSIKURBSA-N |
| XLogP | 4.04 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile?
The IUPAC name of 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile (CID 50924177) is 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile.
What is the SMILES notation for 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile?
The canonical SMILES for 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile is C=CC[C@@](O)(/C=C/c1ccccc1)c1cccc(C#N)c1.
What is the InChIKey of 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile?
The InChIKey is XTKJPAAXMLKTRR-XSSIKURBSA-N. The full InChI is InChI=1S/C19H17NO/c1-2-12-19(21,13-11-16-7-4-3-5-8-16)18-10-6-9-17(14-18)15-20/h2-11,13-14,21H,1,12H2/b13-11+/t19-/m1/s1.
What are the key properties of 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile?
3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile has a molecular weight of 275.35 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1E,3R)-3-hydroxy-1-phenylhexa-1,5-dien-3-yl]benzonitrile is sourced from PubChem (CID 50924177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).