About (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate
(2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 50924259) has the molecular formula C14H17NO5
and a molecular weight of 279.29 g/mol. Its IUPAC name is (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 50924259 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCC(=O)OC(OC(=O)c1cc2occc2[nH]1)C(C)C |
| InChI | InChI=1S/C14H17NO5/c1-4-12(16)19-14(8(2)3)20-13(17)10-7-11-9(15-10)5-6-18-11/h5-8,14-15H,4H2,1-3H3 |
| InChIKey | YBAIWNRRRXUGGC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 50924259) is (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate is CCC(=O)OC(OC(=O)c1cc2occc2[nH]1)C(C)C.
What is the InChIKey of (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is YBAIWNRRRXUGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO5/c1-4-12(16)19-14(8(2)3)20-13(17)10-7-11-9(15-10)5-6-18-11/h5-8,14-15H,4H2,1-3H3.
What are the key properties of (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
(2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 279.29 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1-propanoyloxypropyl) 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 50924259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).