About 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one
7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 50924430) has the molecular formula C17H20N6O
and a molecular weight of 324.39 g/mol. Its IUPAC name is 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 50924430 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)Nc1nc(-c2ccc(N)c(N)c2)cc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C17H20N6O/c1-9(2)21-16-15-14(20-8-23(3)17(15)24)7-13(22-16)10-4-5-11(18)12(19)6-10/h4-9H,18-19H2,1-3H3,(H,21,22) |
| InChIKey | PMTQTESUVISLKW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (CID 50924430) is 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is CC(C)Nc1nc(-c2ccc(N)c(N)c2)cc2ncn(C)c(=O)c12.
What is the InChIKey of 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is PMTQTESUVISLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6O/c1-9(2)21-16-15-14(20-8-23(3)17(15)24)7-13(22-16)10-4-5-11(18)12(19)6-10/h4-9H,18-19H2,1-3H3,(H,21,22).
What are the key properties of 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 324.39 g/mol, XLogP of 1.98, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-diaminophenyl)-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 50924430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).