C23H18F2N6O3S2 — CID 5092468
2-[[4-[4-(difluoromethylsulfanyl)phenyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)acetamide (PubChem CID 5092468) has the molecular formula C23H18F2N6O3S2 and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-[[4-[4-(difluoromethylsulfanyl)phenyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-[4-(difluoromethylsulfanyl)phenyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 5092468 |
| Molecular Formula | C23H18F2N6O3S2 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-[[4-[4-(difluoromethylsulfanyl)phenyl]-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-2-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(-c3cccnc3)n2-c2ccc(SC(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18F2N6O3S2/c1-14-4-9-18(19(11-14)31(33)34)27-20(32)13-35-23-29-28-21(15-3-2-10-26-12-15)30(23)16-5-7-17(8-6-16)36-22(24)25/h2-12,22H,13H2,1H3,(H,27,32) |
| InChIKey | ISVVEPHBMKBCQO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|