C22H34O13 — CID 50924923
(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2Z,4Z,6E,8Z)-5,9-dihydroxydeca-2,4,6,8-tetraen-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 50924923) has the molecular formula C22H34O13 and a molecular weight of 506.50 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2Z,4Z,6E,8Z)-5,9-dihydroxydeca-2,4,6,8-tetraen-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2Z,4Z,6E,8Z)-5,9-dihydroxydeca-2,4,6,8-tetraen-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50924923 |
| Molecular Formula | C22H34O13 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2Z,4Z,6E,8Z)-5,9-dihydroxydeca-2,4,6,8-tetraen-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C/C(O)=C/C=C/C(O)=C/C=C(/C)O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H34O13/c1-10(24)4-3-5-12(25)7-6-11(2)33-22-20(31)18(29)16(27)14(35-22)9-32-21-19(30)17(28)15(26)13(8-23)34-21/h3-7,13-31H,8-9H2,1-2H3/b5-3+,10-4-,11-6-,12-7-/t13-,14-,15-,16-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | ZFYUEDNAKUEKTM-UBWMKYSMSA-N |
| XLogP | -2.01 |
| TPSA | 218.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|