C19H18ClNO2 — CID 50925442
[(1R,3aS,9bS)-3-methyl-2,3a,4,9b-tetrahydro-1H-chromeno[3,4-b]pyrrol-1-yl]-(4-chlorophenyl)methanone (PubChem CID 50925442) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is [(1R,3aS,9bS)-3-methyl-2,3a,4,9b-tetrahydro-1H-chromeno[3,4-b]pyrrol-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [(1R,3aS,9bS)-3-methyl-2,3a,4,9b-tetrahydro-1H-chromeno[3,4-b]pyrrol-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 50925442 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(1R,3aS,9bS)-3-methyl-2,3a,4,9b-tetrahydro-1H-chromeno[3,4-b]pyrrol-1-yl]-(4-chlorophenyl)methanone |
| SMILES | CN1C[C@H](C(=O)c2ccc(Cl)cc2)[C@H]2c3ccccc3OC[C@H]21 |
| InChI | InChI=1S/C19H18ClNO2/c1-21-10-15(19(22)12-6-8-13(20)9-7-12)18-14-4-2-3-5-17(14)23-11-16(18)21/h2-9,15-16,18H,10-11H2,1H3/t15-,16+,18+/m0/s1 |
| InChIKey | JRMUGUICVMPLSH-LZLYRXPVSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |