C38H56O7 — CID 50925487
(2S)-4-[(13S)-8,13-dihydroxy-14-[2-[(2S)-2-hydroxy-5-(4-phenylphenyl)pentoxy]ethoxy]tetradecyl]-2-methyl-2H-furan-5-one (PubChem CID 50925487) has the molecular formula C38H56O7 and a molecular weight of 624.86 g/mol. Its IUPAC name is (2S)-4-[(13S)-8,13-dihydroxy-14-[2-[(2S)-2-hydroxy-5-(4-phenylphenyl)pentoxy]ethoxy]tetradecyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(13S)-8,13-dihydroxy-14-[2-[(2S)-2-hydroxy-5-(4-phenylphenyl)pentoxy]ethoxy]tetradecyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 50925487 |
| Molecular Formula | C38H56O7 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | (2S)-4-[(13S)-8,13-dihydroxy-14-[2-[(2S)-2-hydroxy-5-(4-phenylphenyl)pentoxy]ethoxy]tetradecyl]-2-methyl-2H-furan-5-one |
| SMILES | C[C@H]1C=C(CCCCCCCC(O)CCCC[C@H](O)COCCOC[C@@H](O)CCCc2ccc(-c3ccccc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C38H56O7/c1-30-27-34(38(42)45-30)16-6-3-2-4-9-17-35(39)18-10-11-19-36(40)28-43-25-26-44-29-37(41)20-12-13-31-21-23-33(24-22-31)32-14-7-5-8-15-32/h5,7-8,14-15,21-24,27,30,35-37,39-41H,2-4,6,9-13,16-20,25-26,28-29H2,1H3/t30-,35?,36-,37-/m0/s1 |
| InChIKey | RNFZQDVNXVZRGJ-NCQXBWCDSA-N |
| XLogP | 6.95 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|