C26H20O9 — CID 50925548
10-ethyl-1,5,6,9,14-pentahydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid (PubChem CID 50925548) has the molecular formula C26H20O9 and a molecular weight of 476.44 g/mol. Its IUPAC name is 10-ethyl-1,5,6,9,14-pentahydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid.
| Compound Name | 10-ethyl-1,5,6,9,14-pentahydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 50925548 |
| Molecular Formula | C26H20O9 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 10-ethyl-1,5,6,9,14-pentahydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| SMILES | CCc1ccc2c(c1O)C(=O)c1cc3c(c(O)c1C2=O)-c1c(cc(C)c(C(=O)O)c1O)C(O)C3O |
| InChI | InChI=1S/C26H20O9/c1-3-9-4-5-10-17(19(9)27)21(29)13-7-12-16(25(33)18(13)20(10)28)15-11(22(30)23(12)31)6-8(2)14(24(15)32)26(34)35/h4-7,22-23,27,30-33H,3H2,1-2H3,(H,34,35) |
| InChIKey | GATBAPGKSGYXAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|