C25H27NO — CID 50925607
3-[(E)-3-oxo-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzonitrile (PubChem CID 50925607) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-[(E)-3-oxo-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzonitrile.
| Compound Name | 3-[(E)-3-oxo-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 50925607 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-[(E)-3-oxo-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzonitrile |
| SMILES | Cc1cc2c(cc1C(=O)/C=C/c1cccc(C#N)c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H27NO/c1-17-13-21-22(25(4,5)12-11-24(21,2)3)15-20(17)23(27)10-9-18-7-6-8-19(14-18)16-26/h6-10,13-15H,11-12H2,1-5H3/b10-9+ |
| InChIKey | ZNBAFWVRCLEBNT-MDZDMXLPSA-N |
| XLogP | 6.11 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|