C26H32O3 — CID 50925612
(E)-3-(3,5-dimethoxyphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 50925612) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 50925612 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc(OC)c1 |
| InChI | InChI=1S/C26H32O3/c1-17-12-22-23(26(4,5)11-10-25(22,2)3)16-21(17)24(27)9-8-18-13-19(28-6)15-20(14-18)29-7/h8-9,12-16H,10-11H2,1-7H3/b9-8+ |
| InChIKey | OCHAYZGKJIRVJX-CMDGGOBGSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|