C23H22O5 — CID 509270
5,8-dihydroxy-2,2-dimethyl-7-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one (PubChem CID 509270) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 5,8-dihydroxy-2,2-dimethyl-7-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one.
| Compound Name | 5,8-dihydroxy-2,2-dimethyl-7-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 509270 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 5,8-dihydroxy-2,2-dimethyl-7-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
| SMILES | CC(C)=CCc1c(O)ccc2oc3cc4c(c(O)c3c(=O)c12)C=CC(C)(C)O4 |
| InChI | InChI=1S/C23H22O5/c1-12(2)5-6-13-15(24)7-8-16-19(13)22(26)20-18(27-16)11-17-14(21(20)25)9-10-23(3,4)28-17/h5,7-11,24-25H,6H2,1-4H3 |
| InChIKey | SDKLJUCURHMDBQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|