C11H15N5OS — CID 50928566
2-piperidin-1-yl-5-(sulfanylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 50928566) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-piperidin-1-yl-5-(sulfanylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-piperidin-1-yl-5-(sulfanylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 50928566 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-piperidin-1-yl-5-(sulfanylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(CS)nc2nc(N3CCCCC3)[nH]n12 |
| InChI | InChI=1S/C11H15N5OS/c17-9-6-8(7-18)12-10-13-11(14-16(9)10)15-4-2-1-3-5-15/h6,18H,1-5,7H2,(H,12,13,14) |
| InChIKey | PNWCXPYUBQLWGO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|