C12H8Br2N2O2S — CID 50929991
N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 50929991) has the molecular formula C12H8Br2N2O2S and a molecular weight of 404.08 g/mol. Its IUPAC name is N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 50929991 |
| Molecular Formula | C12H8Br2N2O2S |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | N-[(E)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(O)c(Br)cc1Br)c1cccs1 |
| InChI | InChI=1S/C12H8Br2N2O2S/c13-8-5-9(14)10(17)4-7(8)6-15-16-12(18)11-2-1-3-19-11/h1-6,17H,(H,16,18)/b15-6+ |
| InChIKey | AZLBIVIKSQGNHQ-GIDUJCDVSA-N |
| XLogP | 3.74 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|