C9H15ClO2 — CID 50930555
(1R,2S,4S,5S)-2-chloro-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 50930555) has the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. Its IUPAC name is (1R,2S,4S,5S)-2-chloro-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,4S,5S)-2-chloro-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 50930555 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (1R,2S,4S,5S)-2-chloro-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | C[C@H]1C(O)[C@](C)(Cl)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C9H15ClO2/c1-5-6-3-4-7(12-6)9(2,10)8(5)11/h5-8,11H,3-4H2,1-2H3/t5-,6+,7-,8?,9-/m1/s1 |
| InChIKey | LDMGNBKWQMARPV-JGTGMFPPSA-N |
| XLogP | 1.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|