About 3-cyclohexyl-1,1-dipropylurea
3-cyclohexyl-1,1-dipropylurea (PubChem CID 5093082) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,1-dipropylurea |
| PubChem CID | 5093082 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-cyclohexyl-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-3-10-15(11-4-2)13(16)14-12-8-6-5-7-9-12/h12H,3-11H2,1-2H3,(H,14,16) |
| InChIKey | MYGQFTHNBDDOOK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,1-dipropylurea?
The IUPAC name of 3-cyclohexyl-1,1-dipropylurea (CID 5093082) is 3-cyclohexyl-1,1-dipropylurea.
What is the SMILES notation for 3-cyclohexyl-1,1-dipropylurea?
The canonical SMILES for 3-cyclohexyl-1,1-dipropylurea is CCCN(CCC)C(=O)NC1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1,1-dipropylurea?
The InChIKey is MYGQFTHNBDDOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-3-10-15(11-4-2)13(16)14-12-8-6-5-7-9-12/h12H,3-11H2,1-2H3,(H,14,16).
What are the key properties of 3-cyclohexyl-1,1-dipropylurea?
3-cyclohexyl-1,1-dipropylurea has a molecular weight of 226.36 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,1-dipropylurea is sourced from PubChem (CID 5093082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).