C26H33N3O3S — CID 5093361
N-(4-ethoxyphenyl)-2-(3-heptyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetamide (PubChem CID 5093361) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(3-heptyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(3-heptyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 5093361 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(3-heptyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)acetamide |
| SMILES | CCCCCCCN1C(=S)N(c2ccccc2)C(=O)C1CC(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C26H33N3O3S/c1-3-5-6-7-11-18-28-23(25(31)29(26(28)33)21-12-9-8-10-13-21)19-24(30)27-20-14-16-22(17-15-20)32-4-2/h8-10,12-17,23H,3-7,11,18-19H2,1-2H3,(H,27,30) |
| InChIKey | NYEFDNBPLGGWCT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|