About bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel
bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel (PubChem CID 50934095) has the molecular formula C10H24N6NiS2-2
and a molecular weight of 351.17 g/mol. Its IUPAC name is bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel.
Molecular Properties
| Compound Name | bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel |
| PubChem CID | 50934095 |
| Molecular Formula | C10H24N6NiS2-2 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel |
| SMILES | CC/N=C(\[S-])NN(C)C.CC/N=C(\[S-])NN(C)C.[Ni] |
| InChI | InChI=1S/2C5H13N3S.Ni/c2*1-4-6-5(9)7-8(2)3;/h2*4H2,1-3H3,(H2,6,7,9);/p-2 |
| InChIKey | QMBHBYSWNDRXLW-UHFFFAOYSA-L |
| XLogP | -0.05 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel?
The IUPAC name of bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel (CID 50934095) is bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel.
What is the SMILES notation for bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel?
The canonical SMILES for bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel is CC/N=C(\[S-])NN(C)C.CC/N=C(\[S-])NN(C)C.[Ni].
What is the InChIKey of bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel?
The InChIKey is QMBHBYSWNDRXLW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H13N3S.Ni/c2*1-4-6-5(9)7-8(2)3;/h2*4H2,1-3H3,(H2,6,7,9);/p-2.
What are the key properties of bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel?
bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel has a molecular weight of 351.17 g/mol, XLogP of -0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-(dimethylamino)-N'-ethylcarbamimidothioate);nickel is sourced from PubChem (CID 50934095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).