C27H39NO2 — CID 50936683
tert-butyl 3-[benzyl-[(1R)-1-phenylethyl]amino]octanoate (PubChem CID 50936683) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is tert-butyl 3-[benzyl-[(1R)-1-phenylethyl]amino]octanoate.
| Compound Name | tert-butyl 3-[benzyl-[(1R)-1-phenylethyl]amino]octanoate |
|---|---|
| PubChem CID | 50936683 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | tert-butyl 3-[benzyl-[(1R)-1-phenylethyl]amino]octanoate |
| SMILES | CCCCCC(CC(=O)OC(C)(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H39NO2/c1-6-7-10-19-25(20-26(29)30-27(3,4)5)28(21-23-15-11-8-12-16-23)22(2)24-17-13-9-14-18-24/h8-9,11-18,22,25H,6-7,10,19-21H2,1-5H3/t22-,25?/m1/s1 |
| InChIKey | PDOXFYCRIFSRGZ-UFUCKMQHSA-N |
| XLogP | 6.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|