About methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate
methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 50936859) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 50936859 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COCc1ccc(-c2nc(C(=O)OC)cc3c2[nH]c2ccccc23)o1 |
| InChI | InChI=1S/C19H16N2O4/c1-23-10-11-7-8-16(25-11)18-17-13(9-15(21-18)19(22)24-2)12-5-3-4-6-14(12)20-17/h3-9,20H,10H2,1-2H3 |
| InChIKey | PYPCFKWULKVKRR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate (CID 50936859) is methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate is COCc1ccc(-c2nc(C(=O)OC)cc3c2[nH]c2ccccc23)o1.
What is the InChIKey of methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is PYPCFKWULKVKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-23-10-11-7-8-16(25-11)18-17-13(9-15(21-18)19(22)24-2)12-5-3-4-6-14(12)20-17/h3-9,20H,10H2,1-2H3.
What are the key properties of methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate?
methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 336.35 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[5-(methoxymethyl)furan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 50936859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).