C13H20O5 — CID 50936860
6-heptyl-2,5,6-trihydroxycyclohex-2-ene-1,4-dione (PubChem CID 50936860) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 6-heptyl-2,5,6-trihydroxycyclohex-2-ene-1,4-dione.
| Compound Name | 6-heptyl-2,5,6-trihydroxycyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 50936860 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 6-heptyl-2,5,6-trihydroxycyclohex-2-ene-1,4-dione |
| SMILES | CCCCCCCC1(O)C(=O)C(O)=CC(=O)C1O |
| InChI | InChI=1S/C13H20O5/c1-2-3-4-5-6-7-13(18)11(16)9(14)8-10(15)12(13)17/h8,11,15-16,18H,2-7H2,1H3 |
| InChIKey | FAAARFPJXQMDFP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|