C9H12O3 — CID 50936997
methyl (1R,2R,4S,5S,6S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 50936997) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,6S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,6S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 50936997 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | methyl (1R,2R,4S,5S,6S)-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C[C@@H]1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C9H12O3/c1-11-9(10)6-3-4-2-5(6)8-7(4)12-8/h4-8H,2-3H2,1H3/t4-,5+,6+,7-,8+/m1/s1 |
| InChIKey | IIQHJFLEIHBNPC-HNEXDWKRSA-N |
| XLogP | 0.58 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|