C13H23NO2 — CID 50937363
(1'R,4S,4'S)-3-hydroxy-2,2,2',2'-tetramethylspiro[1,3-oxazolidine-4,3'-bicyclo[2.2.1]heptane] (PubChem CID 50937363) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (1'R,4S,4'S)-3-hydroxy-2,2,2',2'-tetramethylspiro[1,3-oxazolidine-4,3'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,4S,4'S)-3-hydroxy-2,2,2',2'-tetramethylspiro[1,3-oxazolidine-4,3'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 50937363 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1'R,4S,4'S)-3-hydroxy-2,2,2',2'-tetramethylspiro[1,3-oxazolidine-4,3'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)OC[C@@]2([C@H]3CC[C@H](C3)C2(C)C)N1O |
| InChI | InChI=1S/C13H23NO2/c1-11(2)9-5-6-10(7-9)13(11)8-16-12(3,4)14(13)15/h9-10,15H,5-8H2,1-4H3/t9-,10+,13+/m1/s1 |
| InChIKey | KZTYVSUOSFYZPB-NRUUGDAUSA-N |
| XLogP | 2.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |