About (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide
(1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide (PubChem CID 50937727) has the molecular formula C10H15N4O5+
and a molecular weight of 271.25 g/mol. Its IUPAC name is (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide.
Molecular Properties
| Compound Name | (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide |
| PubChem CID | 50937727 |
| Molecular Formula | C10H15N4O5+ |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide |
| SMILES | C[NH+]1C[C@]2([N+](=O)[O-])C=C(C(N)=O)C[C@@]([N+](=O)[O-])(C1)C2 |
| InChI | InChI=1S/C10H14N4O5/c1-12-5-9(13(16)17)2-7(8(11)15)3-10(4-9,6-12)14(18)19/h2H,3-6H2,1H3,(H2,11,15)/p+1/t9-,10-/m0/s1 |
| InChIKey | DPGIQLJYKGILLJ-UWVGGRQHSA-O |
| XLogP | -2.25 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide?
The IUPAC name of (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide (CID 50937727) is (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide.
What is the SMILES notation for (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide?
The canonical SMILES for (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide is C[NH+]1C[C@]2([N+](=O)[O-])C=C(C(N)=O)C[C@@]([N+](=O)[O-])(C1)C2.
What is the InChIKey of (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide?
The InChIKey is DPGIQLJYKGILLJ-UWVGGRQHSA-O. The full InChI is InChI=1S/C10H14N4O5/c1-12-5-9(13(16)17)2-7(8(11)15)3-10(4-9,6-12)14(18)19/h2H,3-6H2,1H3,(H2,11,15)/p+1/t9-,10-/m0/s1.
What are the key properties of (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide?
(1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide has a molecular weight of 271.25 g/mol, XLogP of -2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-methyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-ene-7-carboxamide is sourced from PubChem (CID 50937727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).