C19H33N2O3+ — CID 50937736
(1R,4R)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 50937736) has the molecular formula C19H33N2O3+ and a molecular weight of 337.48 g/mol. Its IUPAC name is (1R,4R)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4R)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 50937736 |
| Molecular Formula | C19H33N2O3+ |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | (1R,4R)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)[C@]23CC[C@@](C)(C(=O)O2)C3(C)C)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C19H32N2O3/c1-15(2)10-12(11-16(3,4)21-15)20-13(22)19-9-8-18(7,14(23)24-19)17(19,5)6/h12,21H,8-11H2,1-7H3,(H,20,22)/p+1/t18-,19-/m0/s1 |
| InChIKey | CUZDFAGGVFIPNK-OALUTQOASA-O |
| XLogP | 1.51 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |