C25H24Cl2FN5O2 — CID 50938638
6-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 50938638) has the molecular formula C25H24Cl2FN5O2 and a molecular weight of 516.40 g/mol. Its IUPAC name is 6-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 6-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 50938638 |
| Molecular Formula | C25H24Cl2FN5O2 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 6-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | C[C@@H](Oc1nc(-c2ccc3c(c2)NC(=O)C32CCN(C)CC2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H24Cl2FN5O2/c1-13(20-16(26)5-6-17(28)21(20)27)35-23-22(29)30-12-19(31-23)14-3-4-15-18(11-14)32-24(34)25(15)7-9-33(2)10-8-25/h3-6,11-13H,7-10H2,1-2H3,(H2,29,30)(H,32,34)/t13-/m1/s1 |
| InChIKey | USZCHXCWTFDLQZ-CYBMUJFWSA-N |
| XLogP | 5.23 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|