C27H27Cl2FN4O2 — CID 50938749
5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-ethylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 50938749) has the molecular formula C27H27Cl2FN4O2 and a molecular weight of 529.44 g/mol. Its IUPAC name is 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-ethylspiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-ethylspiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 50938749 |
| Molecular Formula | C27H27Cl2FN4O2 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-ethylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | CCN1CCC2(CC1)C(=O)Nc1ccc(-c3cnc(N)c(O[C@H](C)c4c(Cl)ccc(F)c4Cl)c3)cc12 |
| InChI | InChI=1S/C27H27Cl2FN4O2/c1-3-34-10-8-27(9-11-34)18-12-16(4-7-21(18)33-26(27)35)17-13-22(25(31)32-14-17)36-15(2)23-19(28)5-6-20(30)24(23)29/h4-7,12-15H,3,8-11H2,1-2H3,(H2,31,32)(H,33,35)/t15-/m1/s1 |
| InChIKey | PJZGHKBFEFJGHK-OAHLLOKOSA-N |
| XLogP | 6.22 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|