C12H15Cl2N5O6 — CID 50938838
1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine;2,3-dihydroxybutanedioic acid (PubChem CID 50938838) has the molecular formula C12H15Cl2N5O6 and a molecular weight of 396.19 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine;2,3-dihydroxybutanedioic acid.
| Compound Name | 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 50938838 |
| Molecular Formula | C12H15Cl2N5O6 |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine;2,3-dihydroxybutanedioic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Cl)c(Cl)c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H9Cl2N5.C4H6O6/c9-5-2-1-4(3-6(5)10)14-8(13)15-7(11)12;5-1(3(7)8)2(6)4(9)10/h1-3H,(H6,11,12,13,14,15);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GMXVXOSMOWDMCL-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|