C30H33N3O2S2 — CID 50938851
4-tert-butyl-15-methoxy-14-pyridin-3-yl-10-thiophen-2-yl-7-thia-1,4-diazatetracyclo[9.8.0.02,9.012,17]nonadeca-10,12,14,16-tetraen-3-one (PubChem CID 50938851) has the molecular formula C30H33N3O2S2 and a molecular weight of 531.75 g/mol. Its IUPAC name is 4-tert-butyl-15-methoxy-14-pyridin-3-yl-10-thiophen-2-yl-7-thia-1,4-diazatetracyclo[9.8.0.02,9.012,17]nonadeca-10,12,14,16-tetraen-3-one.
| Compound Name | 4-tert-butyl-15-methoxy-14-pyridin-3-yl-10-thiophen-2-yl-7-thia-1,4-diazatetracyclo[9.8.0.02,9.012,17]nonadeca-10,12,14,16-tetraen-3-one |
|---|---|
| PubChem CID | 50938851 |
| Molecular Formula | C30H33N3O2S2 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 4-tert-butyl-15-methoxy-14-pyridin-3-yl-10-thiophen-2-yl-7-thia-1,4-diazatetracyclo[9.8.0.02,9.012,17]nonadeca-10,12,14,16-tetraen-3-one |
| SMILES | COc1cc2c(cc1-c1cccnc1)C1=C(c3cccs3)C3CSCCN(C(C)(C)C)C(=O)C3N1CC2 |
| InChI | InChI=1S/C30H33N3O2S2/c1-30(2,3)33-12-14-36-18-23-26(25-8-6-13-37-25)27-22-16-21(20-7-5-10-31-17-20)24(35-4)15-19(22)9-11-32(27)28(23)29(33)34/h5-8,10,13,15-17,23,28H,9,11-12,14,18H2,1-4H3 |
| InChIKey | ICQOKDMBTIWEIZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |