C31H33Cl2FN4O2 — CID 50938864
5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-cyclohexylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 50938864) has the molecular formula C31H33Cl2FN4O2 and a molecular weight of 583.54 g/mol. Its IUPAC name is 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-cyclohexylspiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-cyclohexylspiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 50938864 |
| Molecular Formula | C31H33Cl2FN4O2 |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1'-cyclohexylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c(c2)C2(CCN(C4CCCCC4)CC2)C(=O)N3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C31H33Cl2FN4O2/c1-18(27-23(32)8-9-24(34)28(27)33)40-26-16-20(17-36-29(26)35)19-7-10-25-22(15-19)31(30(39)37-25)11-13-38(14-12-31)21-5-3-2-4-6-21/h7-10,15-18,21H,2-6,11-14H2,1H3,(H2,35,36)(H,37,39)/t18-/m1/s1 |
| InChIKey | BSGUSFGDELWFOS-GOSISDBHSA-N |
| XLogP | 7.54 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|