C27H25F3N2O — CID 50938875
5,17,17-trimethyl-9-[3-(trifluoromethyl)phenyl]-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene (PubChem CID 50938875) has the molecular formula C27H25F3N2O and a molecular weight of 450.50 g/mol. Its IUPAC name is 5,17,17-trimethyl-9-[3-(trifluoromethyl)phenyl]-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene.
| Compound Name | 5,17,17-trimethyl-9-[3-(trifluoromethyl)phenyl]-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene |
|---|---|
| PubChem CID | 50938875 |
| Molecular Formula | C27H25F3N2O |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 5,17,17-trimethyl-9-[3-(trifluoromethyl)phenyl]-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene |
| SMILES | Cc1coc2c1C1NC(c3cccc(C(F)(F)F)c3)=NC1c1c-2ccc2c1CCCC2(C)C |
| InChI | InChI=1S/C27H25F3N2O/c1-14-13-33-24-18-9-10-19-17(8-5-11-26(19,2)3)21(18)23-22(20(14)24)31-25(32-23)15-6-4-7-16(12-15)27(28,29)30/h4,6-7,9-10,12-13,22-23H,5,8,11H2,1-3H3,(H,31,32) |
| InChIKey | WIIIFWKKNPUOIP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |