About 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid
3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid (PubChem CID 50938910) has the molecular formula C9H20O6S3
and a molecular weight of 320.45 g/mol. Its IUPAC name is 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid |
| PubChem CID | 50938910 |
| Molecular Formula | C9H20O6S3 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid |
| SMILES | CC(C)(CCS)COS(=O)(=O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20O6S3/c1-9(2,4-5-16)8-15-18(13,14)7-3-6-17(10,11)12/h16H,3-8H2,1-2H3,(H,10,11,12) |
| InChIKey | NHCCDJLIPCDIRH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid?
The IUPAC name of 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid (CID 50938910) is 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid.
What is the SMILES notation for 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid?
The canonical SMILES for 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid is CC(C)(CCS)COS(=O)(=O)CCCS(=O)(=O)O.
What is the InChIKey of 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid?
The InChIKey is NHCCDJLIPCDIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O6S3/c1-9(2,4-5-16)8-15-18(13,14)7-3-6-17(10,11)12/h16H,3-8H2,1-2H3,(H,10,11,12).
What are the key properties of 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid?
3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid has a molecular weight of 320.45 g/mol, XLogP of 0.96, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyl-4-sulfanylbutoxy)sulfonylpropane-1-sulfonic acid is sourced from PubChem (CID 50938910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).