C29H23FN8 — CID 50938949
4-[3,3-dimethyl-6-(7H-purin-6-yl)-2H-pyrrolo[3,2-b]pyridin-1-yl]-7-fluoro-3-methyl-2-pyridin-2-ylquinoline (PubChem CID 50938949) has the molecular formula C29H23FN8 and a molecular weight of 502.56 g/mol. Its IUPAC name is 4-[3,3-dimethyl-6-(7H-purin-6-yl)-2H-pyrrolo[3,2-b]pyridin-1-yl]-7-fluoro-3-methyl-2-pyridin-2-ylquinoline.
| Compound Name | 4-[3,3-dimethyl-6-(7H-purin-6-yl)-2H-pyrrolo[3,2-b]pyridin-1-yl]-7-fluoro-3-methyl-2-pyridin-2-ylquinoline |
|---|---|
| PubChem CID | 50938949 |
| Molecular Formula | C29H23FN8 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 4-[3,3-dimethyl-6-(7H-purin-6-yl)-2H-pyrrolo[3,2-b]pyridin-1-yl]-7-fluoro-3-methyl-2-pyridin-2-ylquinoline |
| SMILES | Cc1c(-c2ccccn2)nc2cc(F)ccc2c1N1CC(C)(C)c2ncc(-c3ncnc4nc[nH]c34)cc21 |
| InChI | InChI=1S/C29H23FN8/c1-16-23(20-6-4-5-9-31-20)37-21-11-18(30)7-8-19(21)26(16)38-13-29(2,3)27-22(38)10-17(12-32-27)24-25-28(35-14-33-24)36-15-34-25/h4-12,14-15H,13H2,1-3H3,(H,33,34,35,36) |
| InChIKey | AYZXSVXZAICRMA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|