C27H28N2O2 — CID 50938998
9-(4-methoxyphenyl)-5,17,17-trimethyl-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene (PubChem CID 50938998) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-5,17,17-trimethyl-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene.
| Compound Name | 9-(4-methoxyphenyl)-5,17,17-trimethyl-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene |
|---|---|
| PubChem CID | 50938998 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 9-(4-methoxyphenyl)-5,17,17-trimethyl-3-oxa-8,10-diazapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,9,13(18),19-hexaene |
| SMILES | COc1ccc(C2=NC3c4c(ccc5c4CCCC5(C)C)-c4occ(C)c4C3N2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-15-14-31-25-19-11-12-20-18(6-5-13-27(20,2)3)22(19)24-23(21(15)25)28-26(29-24)16-7-9-17(30-4)10-8-16/h7-12,14,23-24H,5-6,13H2,1-4H3,(H,28,29) |
| InChIKey | VUPGAKGAXKVAFT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |