About (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane
(3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane (PubChem CID 50939026) has the molecular formula C18H19F2N3O
and a molecular weight of 331.37 g/mol. Its IUPAC name is (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| PubChem CID | 50939026 |
| Molecular Formula | C18H19F2N3O |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| SMILES | Cc1cc(F)c(-c2ccc(O[C@H]3CN4CCC3CC4)nn2)cc1F |
| InChI | InChI=1S/C18H19F2N3O/c1-11-8-15(20)13(9-14(11)19)16-2-3-18(22-21-16)24-17-10-23-6-4-12(17)5-7-23/h2-3,8-9,12,17H,4-7,10H2,1H3/t17-/m0/s1 |
| InChIKey | QUVNZVHUMJPPGC-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The IUPAC name of (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane (CID 50939026) is (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane.
What is the SMILES notation for (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The canonical SMILES for (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane is Cc1cc(F)c(-c2ccc(O[C@H]3CN4CCC3CC4)nn2)cc1F.
What is the InChIKey of (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
The InChIKey is QUVNZVHUMJPPGC-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H19F2N3O/c1-11-8-15(20)13(9-14(11)19)16-2-3-18(22-21-16)24-17-10-23-6-4-12(17)5-7-23/h2-3,8-9,12,17H,4-7,10H2,1H3/t17-/m0/s1.
What are the key properties of (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane?
(3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane has a molecular weight of 331.37 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[6-(2,5-difluoro-4-methylphenyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 50939026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).