C19H24ClN5O2 — CID 50939110
1-[3-(4-methoxyphenoxy)propyl]-2-phenyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride (PubChem CID 50939110) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenoxy)propyl]-2-phenyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride.
| Compound Name | 1-[3-(4-methoxyphenoxy)propyl]-2-phenyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 50939110 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[3-(4-methoxyphenoxy)propyl]-2-phenyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
| SMILES | COc1ccc(OCCCN2C(N)=NC(N)=NC2c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H23N5O2.ClH/c1-25-15-8-10-16(11-9-15)26-13-5-12-24-17(14-6-3-2-4-7-14)22-18(20)23-19(24)21;/h2-4,6-11,17H,5,12-13H2,1H3,(H4,20,21,22,23);1H |
| InChIKey | ICRJGWRMWBOVRJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|