About 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid
2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid (PubChem CID 50939353) has the molecular formula C12H15ClFN5O6
and a molecular weight of 379.73 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid.
Molecular Properties
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid |
| PubChem CID | 50939353 |
| Molecular Formula | C12H15ClFN5O6 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(F)c(Cl)c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H9ClFN5.C4H6O6/c9-5-3-4(1-2-6(5)10)14-8(13)15-7(11)12;5-1(3(7)8)2(6)4(9)10/h1-3H,(H6,11,12,13,14,15);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GGQVDQCMPCLJPA-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid?
The IUPAC name of 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid (CID 50939353) is 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid.
What is the SMILES notation for 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid?
The canonical SMILES for 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid is NC(N)=N/C(N)=N/c1ccc(F)c(Cl)c1.O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid?
The InChIKey is GGQVDQCMPCLJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClFN5.C4H6O6/c9-5-3-4(1-2-6(5)10)14-8(13)15-7(11)12;5-1(3(7)8)2(6)4(9)10/h1-3H,(H6,11,12,13,14,15);1-2,5-6H,(H,7,8)(H,9,10).
What are the key properties of 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid?
2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid has a molecular weight of 379.73 g/mol, XLogP of -1.42, 4 rotatable bonds, 7 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;2,3-dihydroxybutanedioic acid is sourced from PubChem (CID 50939353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).