C24H14ClF4N4O3S+ — CID 50939379
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(6-fluoro-3-pyridinyl)-5-(trifluoromethoxy)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 50939379) has the molecular formula C24H14ClF4N4O3S+ and a molecular weight of 549.91 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(6-fluoro-3-pyridinyl)-5-(trifluoromethoxy)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(6-fluoro-3-pyridinyl)-5-(trifluoromethoxy)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 50939379 |
| Molecular Formula | C24H14ClF4N4O3S+ |
| Molecular Weight | 549.91 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-[3-(6-fluoro-3-pyridinyl)-5-(trifluoromethoxy)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2cc(OC(F)(F)F)cc(-c3ccc(F)nc3)c2)c(O)[n+](Cc2cnc(Cl)s2)c2ccccn12 |
| InChI | InChI=1S/C24H13ClF4N4O3S/c25-23-31-11-17(37-23)12-33-19-3-1-2-6-32(19)21(34)20(22(33)35)15-7-14(13-4-5-18(26)30-10-13)8-16(9-15)36-24(27,28)29/h1-11H,12H2/p+1 |
| InChIKey | ZIXPPNCLCLEFDT-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|