C20H12ClF3N3O2+ — CID 50939385
1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxy-3-(2,3,6-trifluorophenyl)pyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 50939385) has the molecular formula C20H12ClF3N3O2+ and a molecular weight of 418.78 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxy-3-(2,3,6-trifluorophenyl)pyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxy-3-(2,3,6-trifluorophenyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 50939385 |
| Molecular Formula | C20H12ClF3N3O2+ |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxy-3-(2,3,6-trifluorophenyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2c(F)ccc(F)c2F)c(O)[n+](Cc2ccc(Cl)nc2)c2ccccn12 |
| InChI | InChI=1S/C20H11ClF3N3O2/c21-14-7-4-11(9-25-14)10-27-15-3-1-2-8-26(15)19(28)17(20(27)29)16-12(22)5-6-13(23)18(16)24/h1-9H,10H2/p+1 |
| InChIKey | YXBDJWTZDLIYMS-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|