About 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine
4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine (PubChem CID 50939472) has the molecular formula C24H24ClN3O2
and a molecular weight of 421.93 g/mol. Its IUPAC name is 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine |
| PubChem CID | 50939472 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine |
| SMILES | COc1cc(N2CCOCC2)cc2c1ccn2-c1c(C)c(C)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H24ClN3O2/c1-15-16(2)26-21-5-4-17(25)12-20(21)24(15)28-7-6-19-22(28)13-18(14-23(19)29-3)27-8-10-30-11-9-27/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | KRWFNNPGKCSRQU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine?
The IUPAC name of 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine (CID 50939472) is 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine.
What is the SMILES notation for 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine?
The canonical SMILES for 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine is COc1cc(N2CCOCC2)cc2c1ccn2-c1c(C)c(C)nc2ccc(Cl)cc12.
What is the InChIKey of 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine?
The InChIKey is KRWFNNPGKCSRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24ClN3O2/c1-15-16(2)26-21-5-4-17(25)12-20(21)24(15)28-7-6-19-22(28)13-18(14-23(19)29-3)27-8-10-30-11-9-27/h4-7,12-14H,8-11H2,1-3H3.
What are the key properties of 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine?
4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine has a molecular weight of 421.93 g/mol, XLogP of 5.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(6-chloro-2,3-dimethylquinolin-4-yl)-4-methoxyindol-6-yl]morpholine is sourced from PubChem (CID 50939472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).