C34H33ClFN5O5S — CID 50939585
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)amino]but-2-enamide (PubChem CID 50939585) has the molecular formula C34H33ClFN5O5S and a molecular weight of 678.19 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)amino]but-2-enamide |
|---|---|
| PubChem CID | 50939585 |
| Molecular Formula | C34H33ClFN5O5S |
| Molecular Weight | 678.19 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)amino]but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)/C=C/CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C34H33ClFN5O5S/c1-2-45-32-18-29-27(17-30(32)41-33(42)7-4-12-38-25-10-13-47(43,44)14-11-25)34(23(19-37)20-39-29)40-26-8-9-31(28(35)16-26)46-21-22-5-3-6-24(36)15-22/h3-9,15-18,20,25,38H,2,10-14,21H2,1H3,(H,39,40)(H,41,42)/b7-4+ |
| InChIKey | AUPJIWOHAWOENX-QPJJXVBHSA-N |
| XLogP | 6.28 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.19 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|