C32H31ClFN5O5S — CID 50939718
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(2-methylsulfonylethylamino)but-2-enamide (PubChem CID 50939718) has the molecular formula C32H31ClFN5O5S and a molecular weight of 652.15 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(2-methylsulfonylethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(2-methylsulfonylethylamino)but-2-enamide |
|---|---|
| PubChem CID | 50939718 |
| Molecular Formula | C32H31ClFN5O5S |
| Molecular Weight | 652.15 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(2-methylsulfonylethylamino)but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)/C=C/CNCCS(C)(=O)=O |
| InChI | InChI=1S/C32H31ClFN5O5S/c1-3-43-30-17-27-25(16-28(30)39-31(40)8-5-11-36-12-13-45(2,41)42)32(22(18-35)19-37-27)38-24-9-10-29(26(33)15-24)44-20-21-6-4-7-23(34)14-21/h4-10,14-17,19,36H,3,11-13,20H2,1-2H3,(H,37,38)(H,39,40)/b8-5+ |
| InChIKey | NSXBBQIFDWYJFO-VMPITWQZSA-N |
| XLogP | 5.75 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.15 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|