C35H35ClFN5O5S — CID 50939853
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)methylamino]but-2-enamide (PubChem CID 50939853) has the molecular formula C35H35ClFN5O5S and a molecular weight of 692.21 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)methylamino]but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)methylamino]but-2-enamide |
|---|---|
| PubChem CID | 50939853 |
| Molecular Formula | C35H35ClFN5O5S |
| Molecular Weight | 692.21 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-[(1,1-dioxothian-4-yl)methylamino]but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)/C=C/CNCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C35H35ClFN5O5S/c1-2-46-33-18-30-28(17-31(33)42-34(43)7-4-12-39-20-23-10-13-48(44,45)14-11-23)35(25(19-38)21-40-30)41-27-8-9-32(29(36)16-27)47-22-24-5-3-6-26(37)15-24/h3-9,15-18,21,23,39H,2,10-14,20,22H2,1H3,(H,40,41)(H,42,43)/b7-4+ |
| InChIKey | WTAZONCKENSMHH-QPJJXVBHSA-N |
| XLogP | 6.53 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.21 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|